C21H24FN3O — CID 121382344
2-N-(3-fluoro-4-methoxyphenyl)-6-N,9-dimethyl-5,6,7,8-tetrahydrocarbazole-2,6-diamine (PubChem CID 121382344) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is 2-N-(3-fluoro-4-methoxyphenyl)-6-N,9-dimethyl-5,6,7,8-tetrahydrocarbazole-2,6-diamine.
| Compound Name | 2-N-(3-fluoro-4-methoxyphenyl)-6-N,9-dimethyl-5,6,7,8-tetrahydrocarbazole-2,6-diamine |
|---|---|
| PubChem CID | 121382344 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-N-(3-fluoro-4-methoxyphenyl)-6-N,9-dimethyl-5,6,7,8-tetrahydrocarbazole-2,6-diamine |
| SMILES | CNC1CCc2c(c3ccc(Nc4ccc(OC)c(F)c4)cc3n2C)C1 |
| InChI | InChI=1S/C21H24FN3O/c1-23-13-5-8-19-17(10-13)16-7-4-15(12-20(16)25(19)2)24-14-6-9-21(26-3)18(22)11-14/h4,6-7,9,11-13,23-24H,5,8,10H2,1-3H3 |
| InChIKey | AELJRSCQQQZNDN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|