C12H23N — CID 121382404
(5S,6R)-6-propan-2-yl-1-azaspiro[4.5]decane (PubChem CID 121382404) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (5S,6R)-6-propan-2-yl-1-azaspiro[4.5]decane.
| Compound Name | (5S,6R)-6-propan-2-yl-1-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 121382404 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (5S,6R)-6-propan-2-yl-1-azaspiro[4.5]decane |
| SMILES | CC(C)[C@H]1CCCC[C@]12CCCN2 |
| InChI | InChI=1S/C12H23N/c1-10(2)11-6-3-4-7-12(11)8-5-9-13-12/h10-11,13H,3-9H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | PWYOIUCJXGNRTB-NEPJUHHUSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |