About 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate
2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate (PubChem CID 121382429) has the molecular formula C21H24O6S
and a molecular weight of 404.48 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate |
| PubChem CID | 121382429 |
| Molecular Formula | C21H24O6S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)CCOC(=O)C2(C)COC(c3ccccc3)OC2)cc1 |
| InChI | InChI=1S/C21H24O6S/c1-16-8-10-18(11-9-16)28(23,24)13-12-25-20(22)21(2)14-26-19(27-15-21)17-6-4-3-5-7-17/h3-11,19H,12-15H2,1-2H3 |
| InChIKey | YOGHJPQYOFINER-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate?
The IUPAC name of 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate (CID 121382429) is 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate.
What is the SMILES notation for 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate?
The canonical SMILES for 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate is Cc1ccc(S(=O)(=O)CCOC(=O)C2(C)COC(c3ccccc3)OC2)cc1.
What is the InChIKey of 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate?
The InChIKey is YOGHJPQYOFINER-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O6S/c1-16-8-10-18(11-9-16)28(23,24)13-12-25-20(22)21(2)14-26-19(27-15-21)17-6-4-3-5-7-17/h3-11,19H,12-15H2,1-2H3.
What are the key properties of 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate?
2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate has a molecular weight of 404.48 g/mol, XLogP of 3.06, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)sulfonylethyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate is sourced from PubChem (CID 121382429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).