About 6-(3-methylbutyl)-1,2-dihydropyrimidine
6-(3-methylbutyl)-1,2-dihydropyrimidine (PubChem CID 121383170) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 6-(3-methylbutyl)-1,2-dihydropyrimidine.
Molecular Properties
| Compound Name | 6-(3-methylbutyl)-1,2-dihydropyrimidine |
| PubChem CID | 121383170 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 6-(3-methylbutyl)-1,2-dihydropyrimidine |
| SMILES | CC(C)CCC1=CC=NCN1 |
| InChI | InChI=1S/C9H16N2/c1-8(2)3-4-9-5-6-10-7-11-9/h5-6,8,11H,3-4,7H2,1-2H3 |
| InChIKey | DPJHJKWTQDYQJV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(3-methylbutyl)-1,2-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-methylbutyl)-1,2-dihydropyrimidine?
The IUPAC name of 6-(3-methylbutyl)-1,2-dihydropyrimidine (CID 121383170) is 6-(3-methylbutyl)-1,2-dihydropyrimidine.
What is the SMILES notation for 6-(3-methylbutyl)-1,2-dihydropyrimidine?
The canonical SMILES for 6-(3-methylbutyl)-1,2-dihydropyrimidine is CC(C)CCC1=CC=NCN1.
What is the InChIKey of 6-(3-methylbutyl)-1,2-dihydropyrimidine?
The InChIKey is DPJHJKWTQDYQJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-8(2)3-4-9-5-6-10-7-11-9/h5-6,8,11H,3-4,7H2,1-2H3.
What are the key properties of 6-(3-methylbutyl)-1,2-dihydropyrimidine?
6-(3-methylbutyl)-1,2-dihydropyrimidine has a molecular weight of 152.24 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methylbutyl)-1,2-dihydropyrimidine is sourced from PubChem (CID 121383170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).