C24H30O3 — CID 121383481
1-[(13'S)-16'-ethenyl-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]ethanone (PubChem CID 121383481) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 1-[(13'S)-16'-ethenyl-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]ethanone.
| Compound Name | 1-[(13'S)-16'-ethenyl-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]ethanone |
|---|---|
| PubChem CID | 121383481 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 1-[(13'S)-16'-ethenyl-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]ethanone |
| SMILES | C=CC1=C(C(C)=O)[C@@]2(C)CC=C3C4=C(CCC3C2C1)CC1(CC4)OCCO1 |
| InChI | InChI=1S/C24H30O3/c1-4-16-13-21-20-6-5-17-14-24(26-11-12-27-24)10-8-18(17)19(20)7-9-23(21,3)22(16)15(2)25/h4,7,20-21H,1,5-6,8-14H2,2-3H3/t20?,21?,23-/m0/s1 |
| InChIKey | KAMVBQYFINWKBZ-BBHUYCHWSA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |