C53H102BrN9O14 — CID 121383719
1-[bis[3-[1-[bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]propan-2-yloxycarbonylamino]propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate (PubChem CID 121383719) has the molecular formula C53H102BrN9O14 and a molecular weight of 1169.35 g/mol. Its IUPAC name is 1-[bis[3-[1-[bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]propan-2-yloxycarbonylamino]propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate.
| Compound Name | 1-[bis[3-[1-[bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]propan-2-yloxycarbonylamino]propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 121383719 |
| Molecular Formula | C53H102BrN9O14 |
| Molecular Weight | 1169.35 g/mol |
| Exact Mass | 1167.67 |
| IUPAC Name | 1-[bis[3-[1-[bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]propan-2-yloxycarbonylamino]propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate |
| SMILES | CC(CN(CCCNC(=O)OC(C)(C)C)CCCNC(=O)OC(C)(C)C)OC(=O)NCCCN(CCCNC(=O)OC(C)CN(CCCNC(=O)OC(C)(C)C)CCCNC(=O)OC(C)(C)C)CC(C)OC(=O)C(C)(C)Br |
| InChI | InChI=1S/C53H102BrN9O14/c1-39(71-42(64)53(16,17)54)36-61(30-18-24-55-43(65)72-40(2)37-62(32-20-26-57-45(67)74-49(4,5)6)33-21-27-58-46(68)75-50(7,8)9)31-19-25-56-44(66)73-41(3)38-63(34-22-28-59-47(69)76-51(10,11)12)35-23-29-60-48(70)77-52(13,14)15/h39-41H,18-38H2,1-17H3,(H,55,65)(H,56,66)(H,57,67)(H,58,68)(H,59,69)(H,60,70) |
| InChIKey | QXWYIGHXZGNTRR-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 266.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 77 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1169.35 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|