C13H9F2NS — CID 121383814
4-(2,4-difluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine (PubChem CID 121383814) has the molecular formula C13H9F2NS and a molecular weight of 249.28 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine.
| Compound Name | 4-(2,4-difluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 121383814 |
| Molecular Formula | C13H9F2NS |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 4-(2,4-difluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine |
| SMILES | Fc1ccc(C2=NCCc3sccc32)c(F)c1 |
| InChI | InChI=1S/C13H9F2NS/c14-8-1-2-9(11(15)7-8)13-10-4-6-17-12(10)3-5-16-13/h1-2,4,6-7H,3,5H2 |
| InChIKey | QSNPQWXUIXYJMN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |