About 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine
3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine (PubChem CID 121384031) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine |
| PubChem CID | 121384031 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine |
| SMILES | CC(C)c1cnc2onc(C(C)C)c2c1 |
| InChI | InChI=1S/C12H16N2O/c1-7(2)9-5-10-11(8(3)4)14-15-12(10)13-6-9/h5-8H,1-4H3 |
| InChIKey | RMFWNNHEZIQSTQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine?
The IUPAC name of 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine (CID 121384031) is 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine.
What is the SMILES notation for 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine?
The canonical SMILES for 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine is CC(C)c1cnc2onc(C(C)C)c2c1.
What is the InChIKey of 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine?
The InChIKey is RMFWNNHEZIQSTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-7(2)9-5-10-11(8(3)4)14-15-12(10)13-6-9/h5-8H,1-4H3.
What are the key properties of 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine?
3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine has a molecular weight of 204.27 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-di(propan-2-yl)-[1,2]oxazolo[5,4-b]pyridine is sourced from PubChem (CID 121384031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).