About (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde
(2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde (PubChem CID 121384231) has the molecular formula C7H9F2NO2
and a molecular weight of 177.15 g/mol. Its IUPAC name is (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde.
Molecular Properties
| Compound Name | (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde |
| PubChem CID | 121384231 |
| Molecular Formula | C7H9F2NO2 |
| Molecular Weight | 177.15 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde |
| SMILES | CCN1C(=O)C(F)(F)C[C@@H]1C=O |
| InChI | InChI=1S/C7H9F2NO2/c1-2-10-5(4-11)3-7(8,9)6(10)12/h4-5H,2-3H2,1H3/t5-/m1/s1 |
| InChIKey | WVVQBOVQRWRKHO-RXMQYKEDSA-N |
| XLogP | 0.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.15 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde?
The IUPAC name of (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde (CID 121384231) is (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde.
What is the SMILES notation for (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde?
The canonical SMILES for (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde is CCN1C(=O)C(F)(F)C[C@@H]1C=O.
What is the InChIKey of (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde?
The InChIKey is WVVQBOVQRWRKHO-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H9F2NO2/c1-2-10-5(4-11)3-7(8,9)6(10)12/h4-5H,2-3H2,1H3/t5-/m1/s1.
What are the key properties of (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde?
(2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde has a molecular weight of 177.15 g/mol, XLogP of 0.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde is sourced from PubChem (CID 121384231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).