C43H29N3 — CID 121384390
4-(4-naphthalen-2-ylphenyl)-2-(4-phenylphenyl)-6-(4-pyridin-3-ylphenyl)pyrimidine (PubChem CID 121384390) has the molecular formula C43H29N3 and a molecular weight of 587.73 g/mol. Its IUPAC name is 4-(4-naphthalen-2-ylphenyl)-2-(4-phenylphenyl)-6-(4-pyridin-3-ylphenyl)pyrimidine.
| Compound Name | 4-(4-naphthalen-2-ylphenyl)-2-(4-phenylphenyl)-6-(4-pyridin-3-ylphenyl)pyrimidine |
|---|---|
| PubChem CID | 121384390 |
| Molecular Formula | C43H29N3 |
| Molecular Weight | 587.73 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 4-(4-naphthalen-2-ylphenyl)-2-(4-phenylphenyl)-6-(4-pyridin-3-ylphenyl)pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5cccnc5)cc4)cc(-c4ccc(-c5ccc6ccccc6c5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C43H29N3/c1-2-7-30(8-3-1)32-16-23-37(24-17-32)43-45-41(28-42(46-43)36-21-14-34(15-22-36)40-11-6-26-44-29-40)35-19-12-33(13-20-35)39-25-18-31-9-4-5-10-38(31)27-39/h1-29H |
| InChIKey | ROVCVHDNZIDQHO-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.73 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |