C23H17F5N4O3 — CID 121384769
1-[3-methoxy-2-[[2-methyl-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]methyl]phenyl]-4-methyltetrazol-5-one (PubChem CID 121384769) has the molecular formula C23H17F5N4O3 and a molecular weight of 492.40 g/mol. Its IUPAC name is 1-[3-methoxy-2-[[2-methyl-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]methyl]phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[3-methoxy-2-[[2-methyl-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]methyl]phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 121384769 |
| Molecular Formula | C23H17F5N4O3 |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 1-[3-methoxy-2-[[2-methyl-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]methyl]phenyl]-4-methyltetrazol-5-one |
| SMILES | COc1cccc(-n2nnn(C)c2=O)c1COc1ccc(-c2c(F)c(F)c(F)c(F)c2F)cc1C |
| InChI | InChI=1S/C23H17F5N4O3/c1-11-9-12(17-18(24)20(26)22(28)21(27)19(17)25)7-8-15(11)35-10-13-14(5-4-6-16(13)34-3)32-23(33)31(2)29-30-32/h4-9H,10H2,1-3H3 |
| InChIKey | HESAZMQRMRSFQP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|