C51H31N7 — CID 121384789
2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(1,10-phenanthrolin-2-yl)phenyl]phenyl]-1,10-phenanthroline (PubChem CID 121384789) has the molecular formula C51H31N7 and a molecular weight of 741.86 g/mol. Its IUPAC name is 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(1,10-phenanthrolin-2-yl)phenyl]phenyl]-1,10-phenanthroline.
| Compound Name | 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(1,10-phenanthrolin-2-yl)phenyl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 121384789 |
| Molecular Formula | C51H31N7 |
| Molecular Weight | 741.86 g/mol |
| Exact Mass | 741.26 |
| IUPAC Name | 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(1,10-phenanthrolin-2-yl)phenyl]phenyl]-1,10-phenanthroline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cc(-c4cccc(-c5ccc6ccc7cccnc7c6n5)c4)cc(-c4ccc5ccc6cccnc6c5n4)c3)n2)cc1 |
| InChI | InChI=1S/C51H31N7/c1-3-10-36(11-4-1)49-56-50(37-12-5-2-6-13-37)58-51(57-49)42-30-40(29-41(31-42)44-25-23-35-21-19-33-17-9-27-53-46(33)48(35)55-44)38-14-7-15-39(28-38)43-24-22-34-20-18-32-16-8-26-52-45(32)47(34)54-43/h1-31H |
| InChIKey | LFELLAANGDVALV-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.86 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|