C33H20BrN5 — CID 121384792
2-[3-bromo-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthroline (PubChem CID 121384792) has the molecular formula C33H20BrN5 and a molecular weight of 566.46 g/mol. Its IUPAC name is 2-[3-bromo-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthroline.
| Compound Name | 2-[3-bromo-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 121384792 |
| Molecular Formula | C33H20BrN5 |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 565.09 |
| IUPAC Name | 2-[3-bromo-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthroline |
| SMILES | Brc1cc(-c2ccc3ccc4cccnc4c3n2)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C33H20BrN5/c34-27-19-25(28-16-15-22-14-13-21-12-7-17-35-29(21)30(22)36-28)18-26(20-27)33-38-31(23-8-3-1-4-9-23)37-32(39-33)24-10-5-2-6-11-24/h1-20H |
| InChIKey | HDRRISVOFIQPHU-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|