C13H23N — CID 121385149
(2S,3S,4S,5S)-1-ethyl-2,3,4,5-tetramethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]pyrrole (PubChem CID 121385149) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (2S,3S,4S,5S)-1-ethyl-2,3,4,5-tetramethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]pyrrole.
| Compound Name | (2S,3S,4S,5S)-1-ethyl-2,3,4,5-tetramethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]pyrrole |
|---|---|
| PubChem CID | 121385149 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (2S,3S,4S,5S)-1-ethyl-2,3,4,5-tetramethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]pyrrole |
| SMILES | CCN1C2=C([C@@H](C)[C@@H](C)C2)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C13H23N/c1-6-14-11(5)10(4)13-9(3)8(2)7-12(13)14/h8-11H,6-7H2,1-5H3/t8-,9-,10+,11-/m0/s1 |
| InChIKey | OPFNJNMBWORNME-MMWGEVLESA-N |
| XLogP | 3.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |