C11H12FN3 — CID 121385602
11-fluoro-5-methyl-5,8,9-triazatricyclo[7.4.0.02,7]trideca-1,7,10,12-tetraene (PubChem CID 121385602) has the molecular formula C11H12FN3 and a molecular weight of 205.24 g/mol. Its IUPAC name is 11-fluoro-5-methyl-5,8,9-triazatricyclo[7.4.0.02,7]trideca-1,7,10,12-tetraene.
| Compound Name | 11-fluoro-5-methyl-5,8,9-triazatricyclo[7.4.0.02,7]trideca-1,7,10,12-tetraene |
|---|---|
| PubChem CID | 121385602 |
| Molecular Formula | C11H12FN3 |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 11-fluoro-5-methyl-5,8,9-triazatricyclo[7.4.0.02,7]trideca-1,7,10,12-tetraene |
| SMILES | CN1CCc2c(nn3cc(F)ccc23)C1 |
| InChI | InChI=1S/C11H12FN3/c1-14-5-4-9-10(7-14)13-15-6-8(12)2-3-11(9)15/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | QXJRYKRGCTVXBO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |