C8H10F3NO — CID 121385750
(E,2Z,4Z)-3-methyl-N-(trifluoromethoxy)hexa-2,4-dien-1-imine (PubChem CID 121385750) has the molecular formula C8H10F3NO and a molecular weight of 193.17 g/mol. Its IUPAC name is (E,2Z,4Z)-3-methyl-N-(trifluoromethoxy)hexa-2,4-dien-1-imine.
| Compound Name | (E,2Z,4Z)-3-methyl-N-(trifluoromethoxy)hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 121385750 |
| Molecular Formula | C8H10F3NO |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (E,2Z,4Z)-3-methyl-N-(trifluoromethoxy)hexa-2,4-dien-1-imine |
| SMILES | C/C=C\C(C)=C/C=N/OC(F)(F)F |
| InChI | InChI=1S/C8H10F3NO/c1-3-4-7(2)5-6-12-13-8(9,10)11/h3-6H,1-2H3/b4-3-,7-5-,12-6+ |
| InChIKey | NLBFACDPZJRKMT-JJCIYCMXSA-N |
| XLogP | 3.03 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|