C12H13FN2 — CID 121385904
4-(3-fluoro-4-methylphenyl)-1,5-dimethylpyrazole (PubChem CID 121385904) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is 4-(3-fluoro-4-methylphenyl)-1,5-dimethylpyrazole.
| Compound Name | 4-(3-fluoro-4-methylphenyl)-1,5-dimethylpyrazole |
|---|---|
| PubChem CID | 121385904 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 4-(3-fluoro-4-methylphenyl)-1,5-dimethylpyrazole |
| SMILES | Cc1ccc(-c2cnn(C)c2C)cc1F |
| InChI | InChI=1S/C12H13FN2/c1-8-4-5-10(6-12(8)13)11-7-14-15(3)9(11)2/h4-7H,1-3H3 |
| InChIKey | WHMGAMARRAJATB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |