C21H37N3 — CID 121386773
N'-(2,8-ditert-butyl-3,4-dihydro-1H-isoquinolin-6-yl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 121386773) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is N'-(2,8-ditert-butyl-3,4-dihydro-1H-isoquinolin-6-yl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-(2,8-ditert-butyl-3,4-dihydro-1H-isoquinolin-6-yl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 121386773 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | N'-(2,8-ditert-butyl-3,4-dihydro-1H-isoquinolin-6-yl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)c1cc2c(c(C(C)(C)C)c1)CN(C(C)(C)C)CC2 |
| InChI | InChI=1S/C21H37N3/c1-20(2,3)19-14-17(23(8)12-10-22-7)13-16-9-11-24(15-18(16)19)21(4,5)6/h13-14,22H,9-12,15H2,1-8H3 |
| InChIKey | QQZDQOSOXQJFKX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|