C16H18N2O — CID 121386921
(2S,3Z,8R)-2-amino-3-ethylidene-6-methyl-11-azatetracyclo[8.4.0.02,4.04,8]tetradeca-1(10),6,13-trien-12-one (PubChem CID 121386921) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is (2S,3Z,8R)-2-amino-3-ethylidene-6-methyl-11-azatetracyclo[8.4.0.02,4.04,8]tetradeca-1(10),6,13-trien-12-one.
| Compound Name | (2S,3Z,8R)-2-amino-3-ethylidene-6-methyl-11-azatetracyclo[8.4.0.02,4.04,8]tetradeca-1(10),6,13-trien-12-one |
|---|---|
| PubChem CID | 121386921 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (2S,3Z,8R)-2-amino-3-ethylidene-6-methyl-11-azatetracyclo[8.4.0.02,4.04,8]tetradeca-1(10),6,13-trien-12-one |
| SMILES | C/C=C1/C23CC(C)=C[C@H]2Cc2[nH]c(=O)ccc2[C@]13N |
| InChI | InChI=1S/C16H18N2O/c1-3-13-15-8-9(2)6-10(15)7-12-11(16(13,15)17)4-5-14(19)18-12/h3-6,10H,7-8,17H2,1-2H3,(H,18,19)/b13-3-/t10-,15?,16-/m0/s1 |
| InChIKey | NFTBGGPCXGRRBK-ZRDUTIKYSA-N |
| XLogP | 2.00 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|