C15H29N — CID 121386972
(5E,9E)-N,N,5,9-tetramethylundeca-5,9-dien-1-amine (PubChem CID 121386972) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is (5E,9E)-N,N,5,9-tetramethylundeca-5,9-dien-1-amine.
| Compound Name | (5E,9E)-N,N,5,9-tetramethylundeca-5,9-dien-1-amine |
|---|---|
| PubChem CID | 121386972 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | (5E,9E)-N,N,5,9-tetramethylundeca-5,9-dien-1-amine |
| SMILES | C/C=C(\C)CC/C=C(\C)CCCCN(C)C |
| InChI | InChI=1S/C15H29N/c1-6-14(2)11-9-12-15(3)10-7-8-13-16(4)5/h6,12H,7-11,13H2,1-5H3/b14-6+,15-12+ |
| InChIKey | ZXJXCRHGCQMWCW-BUJBXKITSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|