C25H22ClF5N6O2S — CID 121387147
2-[5-chloro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-5-methyl-5-(4-methylsulfonylphenyl)-6,7-dihydropyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 121387147) has the molecular formula C25H22ClF5N6O2S and a molecular weight of 601.00 g/mol. Its IUPAC name is 2-[5-chloro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-5-methyl-5-(4-methylsulfonylphenyl)-6,7-dihydropyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[5-chloro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-5-methyl-5-(4-methylsulfonylphenyl)-6,7-dihydropyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 121387147 |
| Molecular Formula | C25H22ClF5N6O2S |
| Molecular Weight | 601.00 g/mol |
| Exact Mass | 600.11 |
| IUPAC Name | 2-[5-chloro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-5-methyl-5-(4-methylsulfonylphenyl)-6,7-dihydropyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC1(c2ccc(S(C)(=O)=O)cc2)CNc2nc(-n3nc(CCC(F)(F)C(F)(F)F)c4cc(Cl)ccc43)nc(N)c21 |
| InChI | InChI=1S/C25H22ClF5N6O2S/c1-23(13-3-6-15(7-4-13)40(2,38)39)12-33-21-19(23)20(32)34-22(35-21)37-18-8-5-14(26)11-16(18)17(36-37)9-10-24(27,28)25(29,30)31/h3-8,11H,9-10,12H2,1-2H3,(H3,32,33,34,35) |
| InChIKey | OPMYTFIEUOXMOP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.00 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|