C9H12O4 — CID 121387263
2,3-dimethoxy-5-methylcyclohex-2-ene-1,4-dione (PubChem CID 121387263) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methylcyclohex-2-ene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-methylcyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 121387263 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2,3-dimethoxy-5-methylcyclohex-2-ene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(C)CC1=O |
| InChI | InChI=1S/C9H12O4/c1-5-4-6(10)8(12-2)9(13-3)7(5)11/h5H,4H2,1-3H3 |
| InChIKey | QQFGJNSKWXRPJD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |