C24H35NO10 — CID 121387843
1-[1-[(4S)-3,4,5-trihydroxy-6-[[(3S)-1,2,3,4-tetrahydroxy-5-methylhexoxy]methyl]oxan-2-yl]indol-3-yl]propan-2-one (PubChem CID 121387843) has the molecular formula C24H35NO10 and a molecular weight of 497.54 g/mol. Its IUPAC name is 1-[1-[(4S)-3,4,5-trihydroxy-6-[[(3S)-1,2,3,4-tetrahydroxy-5-methylhexoxy]methyl]oxan-2-yl]indol-3-yl]propan-2-one.
| Compound Name | 1-[1-[(4S)-3,4,5-trihydroxy-6-[[(3S)-1,2,3,4-tetrahydroxy-5-methylhexoxy]methyl]oxan-2-yl]indol-3-yl]propan-2-one |
|---|---|
| PubChem CID | 121387843 |
| Molecular Formula | C24H35NO10 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 1-[1-[(4S)-3,4,5-trihydroxy-6-[[(3S)-1,2,3,4-tetrahydroxy-5-methylhexoxy]methyl]oxan-2-yl]indol-3-yl]propan-2-one |
| SMILES | CC(=O)Cc1cn(C2OC(COC(O)C(O)[C@@H](O)C(O)C(C)C)C(O)[C@H](O)C2O)c2ccccc12 |
| InChI | InChI=1S/C24H35NO10/c1-11(2)17(27)19(29)22(32)24(33)34-10-16-18(28)20(30)21(31)23(35-16)25-9-13(8-12(3)26)14-6-4-5-7-15(14)25/h4-7,9,11,16-24,27-33H,8,10H2,1-3H3/t16?,17?,18?,19-,20-,21?,22?,23?,24?/m0/s1 |
| InChIKey | NDSZYEGXAVVPLJ-UGXBJDOXSA-N |
| XLogP | -1.17 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|