C12H22N2 — CID 121388695
(2E,4E)-1-N-ethyl-1-N-methyl-2-prop-1-en-2-ylhexa-2,4-diene-1,4-diamine (PubChem CID 121388695) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (2E,4E)-1-N-ethyl-1-N-methyl-2-prop-1-en-2-ylhexa-2,4-diene-1,4-diamine.
| Compound Name | (2E,4E)-1-N-ethyl-1-N-methyl-2-prop-1-en-2-ylhexa-2,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 121388695 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (2E,4E)-1-N-ethyl-1-N-methyl-2-prop-1-en-2-ylhexa-2,4-diene-1,4-diamine |
| SMILES | C=C(C)/C(=C\C(N)=C/C)CN(C)CC |
| InChI | InChI=1S/C12H22N2/c1-6-12(13)8-11(10(3)4)9-14(5)7-2/h6,8H,3,7,9,13H2,1-2,4-5H3/b11-8-,12-6- |
| InChIKey | QDGHCDJACZJRKE-JQPTUTRNSA-N |
| XLogP | 2.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|