About methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate
methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate (PubChem CID 121389053) has the molecular formula C5H11N3S
and a molecular weight of 145.23 g/mol. Its IUPAC name is methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate.
Molecular Properties
| Compound Name | methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate |
| PubChem CID | 121389053 |
| Molecular Formula | C5H11N3S |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate |
| SMILES | C/C=N/N/C(=N/C)SC |
| InChI | InChI=1S/C5H11N3S/c1-4-7-8-5(6-2)9-3/h4H,1-3H3,(H,6,8)/b7-4+ |
| InChIKey | HAICTTWOFDYWGL-QPJJXVBHSA-N |
| XLogP | 0.93 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate?
The IUPAC name of methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate (CID 121389053) is methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate.
What is the SMILES notation for methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate?
The canonical SMILES for methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate is C/C=N/N/C(=N/C)SC.
What is the InChIKey of methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate?
The InChIKey is HAICTTWOFDYWGL-QPJJXVBHSA-N. The full InChI is InChI=1S/C5H11N3S/c1-4-7-8-5(6-2)9-3/h4H,1-3H3,(H,6,8)/b7-4+.
What are the key properties of methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate?
methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate has a molecular weight of 145.23 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(E)-ethylideneamino]-N'-methylcarbamimidothioate is sourced from PubChem (CID 121389053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).