C26H33N3O4 — CID 121389303
[8-[(2R,3R)-2-methyloxolan-3-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone (PubChem CID 121389303) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is [8-[(2R,3R)-2-methyloxolan-3-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone.
| Compound Name | [8-[(2R,3R)-2-methyloxolan-3-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone |
|---|---|
| PubChem CID | 121389303 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | [8-[(2R,3R)-2-methyloxolan-3-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone |
| SMILES | CC(C)O[C@H]1CC[C@H](C(=O)N2Cc3cccnc3Nc3ccc([C@H]4CCO[C@@H]4C)cc32)OC1 |
| InChI | InChI=1S/C26H33N3O4/c1-16(2)33-20-7-9-24(32-15-20)26(30)29-14-19-5-4-11-27-25(19)28-22-8-6-18(13-23(22)29)21-10-12-31-17(21)3/h4-6,8,11,13,16-17,20-21,24H,7,9-10,12,14-15H2,1-3H3,(H,27,28)/t17-,20+,21+,24-/m1/s1 |
| InChIKey | YDXBXDSZTRZPOO-OTXOCUIESA-N |
| XLogP | 4.54 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |