C25H28F3N5O2 — CID 121389443
[8-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone (PubChem CID 121389443) has the molecular formula C25H28F3N5O2 and a molecular weight of 487.53 g/mol. Its IUPAC name is [8-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone.
| Compound Name | [8-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 121389443 |
| Molecular Formula | C25H28F3N5O2 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | [8-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(CC(F)(F)F)CC1)N1Cc2cccnc2Nc2ccc(N3C[C@H]4C[C@@H]3CO4)cc21 |
| InChI | InChI=1S/C25H28F3N5O2/c26-25(27,28)15-31-8-5-16(6-9-31)24(34)33-12-17-2-1-7-29-23(17)30-21-4-3-18(11-22(21)33)32-13-20-10-19(32)14-35-20/h1-4,7,11,16,19-20H,5-6,8-10,12-15H2,(H,29,30)/t19-,20-/m1/s1 |
| InChIKey | LGTFVVXEGKRFMU-WOJBJXKFSA-N |
| XLogP | 3.92 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |