C26H29N5O2 — CID 121389615
[8-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-methoxycyclohexyl)methanone (PubChem CID 121389615) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is [8-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-methoxycyclohexyl)methanone.
| Compound Name | [8-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-methoxycyclohexyl)methanone |
|---|---|
| PubChem CID | 121389615 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | [8-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-methoxycyclohexyl)methanone |
| SMILES | COC1CCC(C(=O)N2Cc3cccnc3Nc3ccc(-c4cnn5c4CCC5)cc32)CC1 |
| InChI | InChI=1S/C26H29N5O2/c1-33-20-9-6-17(7-10-20)26(32)30-16-19-4-2-12-27-25(19)29-22-11-8-18(14-24(22)30)21-15-28-31-13-3-5-23(21)31/h2,4,8,11-12,14-15,17,20H,3,5-7,9-10,13,16H2,1H3,(H,27,29) |
| InChIKey | CTJRVMKDIXGLMJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |