C25H26F3N5O2 — CID 121389652
[8-(1-methylpyrazol-3-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[4-(2,2,2-trifluoroethoxy)cyclohexyl]methanone (PubChem CID 121389652) has the molecular formula C25H26F3N5O2 and a molecular weight of 485.51 g/mol. Its IUPAC name is [8-(1-methylpyrazol-3-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[4-(2,2,2-trifluoroethoxy)cyclohexyl]methanone.
| Compound Name | [8-(1-methylpyrazol-3-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[4-(2,2,2-trifluoroethoxy)cyclohexyl]methanone |
|---|---|
| PubChem CID | 121389652 |
| Molecular Formula | C25H26F3N5O2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | [8-(1-methylpyrazol-3-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[4-(2,2,2-trifluoroethoxy)cyclohexyl]methanone |
| SMILES | Cn1ccc(-c2ccc3c(c2)N(C(=O)C2CCC(OCC(F)(F)F)CC2)Cc2cccnc2N3)n1 |
| InChI | InChI=1S/C25H26F3N5O2/c1-32-12-10-20(31-32)17-6-9-21-22(13-17)33(14-18-3-2-11-29-23(18)30-21)24(34)16-4-7-19(8-5-16)35-15-25(26,27)28/h2-3,6,9-13,16,19H,4-5,7-8,14-15H2,1H3,(H,29,30) |
| InChIKey | MTIVODBSIRXSFG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |