C27H31N5O2 — CID 121389736
[8-(3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-methoxycyclohexyl)methanone (PubChem CID 121389736) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is [8-(3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-methoxycyclohexyl)methanone.
| Compound Name | [8-(3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-methoxycyclohexyl)methanone |
|---|---|
| PubChem CID | 121389736 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | [8-(3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-methoxycyclohexyl)methanone |
| SMILES | COC1CCC(C(=O)N2Cc3cccnc3Nc3ccc(N4CCn5cccc5C4)cc32)CC1 |
| InChI | InChI=1S/C27H31N5O2/c1-34-23-9-6-19(7-10-23)27(33)32-17-20-4-2-12-28-26(20)29-24-11-8-21(16-25(24)32)31-15-14-30-13-3-5-22(30)18-31/h2-5,8,11-13,16,19,23H,6-7,9-10,14-15,17-18H2,1H3,(H,28,29) |
| InChIKey | JEOLCVWADQOMKA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |