C26H31F2N3O4 — CID 121389819
[8-[2-(difluoromethoxymethyl)cyclopropyl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone (PubChem CID 121389819) has the molecular formula C26H31F2N3O4 and a molecular weight of 487.55 g/mol. Its IUPAC name is [8-[2-(difluoromethoxymethyl)cyclopropyl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone.
| Compound Name | [8-[2-(difluoromethoxymethyl)cyclopropyl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone |
|---|---|
| PubChem CID | 121389819 |
| Molecular Formula | C26H31F2N3O4 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | [8-[2-(difluoromethoxymethyl)cyclopropyl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone |
| SMILES | CC(C)O[C@H]1CC[C@H](C(=O)N2Cc3cccnc3Nc3ccc(C4CC4COC(F)F)cc32)OC1 |
| InChI | InChI=1S/C26H31F2N3O4/c1-15(2)35-19-6-8-23(33-14-19)25(32)31-12-17-4-3-9-29-24(17)30-21-7-5-16(11-22(21)31)20-10-18(20)13-34-26(27)28/h3-5,7,9,11,15,18-20,23,26H,6,8,10,12-14H2,1-2H3,(H,29,30)/t18?,19-,20?,23+/m0/s1 |
| InChIKey | YJLYYSXIWUNRFH-VOIIDZAXSA-N |
| XLogP | 4.99 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |