C25H21ClN6O2 — CID 121389910
3-[(4-chlorophenyl)methyl]-7-ethyl-2-(4-pyridin-2-yloxyanilino)purin-6-one (PubChem CID 121389910) has the molecular formula C25H21ClN6O2 and a molecular weight of 472.94 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-7-ethyl-2-(4-pyridin-2-yloxyanilino)purin-6-one.
| Compound Name | 3-[(4-chlorophenyl)methyl]-7-ethyl-2-(4-pyridin-2-yloxyanilino)purin-6-one |
|---|---|
| PubChem CID | 121389910 |
| Molecular Formula | C25H21ClN6O2 |
| Molecular Weight | 472.94 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-7-ethyl-2-(4-pyridin-2-yloxyanilino)purin-6-one |
| SMILES | CCn1cnc2c1c(=O)nc(Nc1ccc(Oc3ccccn3)cc1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21ClN6O2/c1-2-31-16-28-23-22(31)24(33)30-25(32(23)15-17-6-8-18(26)9-7-17)29-19-10-12-20(13-11-19)34-21-5-3-4-14-27-21/h3-14,16H,2,15H2,1H3,(H,29,30,33) |
| InChIKey | YUHFBNRBHYFVPP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.94 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |