C22H19ClF3N5O2 — CID 121389919
3-[(4-chlorophenyl)methyl]-7-ethyl-2-[4-(2,2,2-trifluoroethoxy)anilino]purin-6-one (PubChem CID 121389919) has the molecular formula C22H19ClF3N5O2 and a molecular weight of 477.87 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-7-ethyl-2-[4-(2,2,2-trifluoroethoxy)anilino]purin-6-one.
| Compound Name | 3-[(4-chlorophenyl)methyl]-7-ethyl-2-[4-(2,2,2-trifluoroethoxy)anilino]purin-6-one |
|---|---|
| PubChem CID | 121389919 |
| Molecular Formula | C22H19ClF3N5O2 |
| Molecular Weight | 477.87 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-7-ethyl-2-[4-(2,2,2-trifluoroethoxy)anilino]purin-6-one |
| SMILES | CCn1cnc2c1c(=O)nc(Nc1ccc(OCC(F)(F)F)cc1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClF3N5O2/c1-2-30-13-27-19-18(30)20(32)29-21(31(19)11-14-3-5-15(23)6-4-14)28-16-7-9-17(10-8-16)33-12-22(24,25)26/h3-10,13H,2,11-12H2,1H3,(H,28,29,32) |
| InChIKey | XPXOCFHWSPMUDZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.87 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |