C43H86BrN9O10 — CID 121389968
1-[bis[3-[1-[3-aminopropyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]propan-2-yloxycarbonylamino]propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate (PubChem CID 121389968) has the molecular formula C43H86BrN9O10 and a molecular weight of 969.12 g/mol. Its IUPAC name is 1-[bis[3-[1-[3-aminopropyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]propan-2-yloxycarbonylamino]propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate.
| Compound Name | 1-[bis[3-[1-[3-aminopropyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]propan-2-yloxycarbonylamino]propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 121389968 |
| Molecular Formula | C43H86BrN9O10 |
| Molecular Weight | 969.12 g/mol |
| Exact Mass | 967.57 |
| IUPAC Name | 1-[bis[3-[1-[3-aminopropyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]propan-2-yloxycarbonylamino]propyl]amino]propan-2-yl 2-bromo-2-methylpropanoate |
| SMILES | CC(CN(CCCN)CCCNC(=O)OC(C)(C)C)OC(=O)NCCCN(CCCNC(=O)OC(C)CN(CCCN)CCCNC(=O)OC(C)(C)C)CC(C)OC(=O)C(C)(C)Br |
| InChI | InChI=1S/C43H86BrN9O10/c1-33(59-36(54)43(10,11)44)30-53(28-14-20-47-37(55)60-34(2)31-51(24-12-18-45)26-16-22-49-39(57)62-41(4,5)6)29-15-21-48-38(56)61-35(3)32-52(25-13-19-46)27-17-23-50-40(58)63-42(7,8)9/h33-35H,12-32,45-46H2,1-11H3,(H,47,55)(H,48,56)(H,49,57)(H,50,58) |
| InChIKey | SFUGWJZDOPUTEK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 241.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.12 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|