C31H30F2N4O4 — CID 121390075
3-[7-[[4-[[4-(3,5-difluorophenyl)piperazin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 121390075) has the molecular formula C31H30F2N4O4 and a molecular weight of 560.60 g/mol. Its IUPAC name is 3-[7-[[4-[[4-(3,5-difluorophenyl)piperazin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-[[4-(3,5-difluorophenyl)piperazin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 121390075 |
| Molecular Formula | C31H30F2N4O4 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 3-[7-[[4-[[4-(3,5-difluorophenyl)piperazin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(OCc4ccc(CN5CCN(c6cc(F)cc(F)c6)CC5)cc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H30F2N4O4/c32-22-14-23(33)16-24(15-22)36-12-10-35(11-13-36)17-20-4-6-21(7-5-20)19-41-28-3-1-2-25-26(28)18-37(31(25)40)27-8-9-29(38)34-30(27)39/h1-7,14-16,27H,8-13,17-19H2,(H,34,38,39) |
| InChIKey | ZHCGTLPGTPHIAJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|