C11H12N4O2 — CID 121390098
(3S)-3-amino-1-(benzotriazol-1-yl)pentane-1,4-dione (PubChem CID 121390098) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is (3S)-3-amino-1-(benzotriazol-1-yl)pentane-1,4-dione.
| Compound Name | (3S)-3-amino-1-(benzotriazol-1-yl)pentane-1,4-dione |
|---|---|
| PubChem CID | 121390098 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (3S)-3-amino-1-(benzotriazol-1-yl)pentane-1,4-dione |
| SMILES | CC(=O)[C@@H](N)CC(=O)n1nnc2ccccc21 |
| InChI | InChI=1S/C11H12N4O2/c1-7(16)8(12)6-11(17)15-10-5-3-2-4-9(10)13-14-15/h2-5,8H,6,12H2,1H3/t8-/m0/s1 |
| InChIKey | ANAUGOLAGNUTFX-QMMMGPOBSA-N |
| XLogP | 0.38 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |