About 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole
3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole (PubChem CID 121390390) has the molecular formula C6H13N3O
and a molecular weight of 143.19 g/mol. Its IUPAC name is 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole.
Molecular Properties
| Compound Name | 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole |
| PubChem CID | 121390390 |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole |
| SMILES | CCN1C=C(COC)NN1 |
| InChI | InChI=1S/C6H13N3O/c1-3-9-4-6(5-10-2)7-8-9/h4,7-8H,3,5H2,1-2H3 |
| InChIKey | VKLLDAUKSYJZNC-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole?
The IUPAC name of 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole (CID 121390390) is 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole.
What is the SMILES notation for 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole?
The canonical SMILES for 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole is CCN1C=C(COC)NN1.
What is the InChIKey of 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole?
The InChIKey is VKLLDAUKSYJZNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O/c1-3-9-4-6(5-10-2)7-8-9/h4,7-8H,3,5H2,1-2H3.
What are the key properties of 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole?
3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole has a molecular weight of 143.19 g/mol, XLogP of -0.18, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-(methoxymethyl)-1,2-dihydrotriazole is sourced from PubChem (CID 121390390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).