C17H14F5N5O3S2 — CID 121390570
5-(1-cyanocyclopropyl)-3-ethylsulfonyl-N-[3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-ylidene]pyridine-2-carboxamide (PubChem CID 121390570) has the molecular formula C17H14F5N5O3S2 and a molecular weight of 495.46 g/mol. Its IUPAC name is 5-(1-cyanocyclopropyl)-3-ethylsulfonyl-N-[3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-ylidene]pyridine-2-carboxamide.
| Compound Name | 5-(1-cyanocyclopropyl)-3-ethylsulfonyl-N-[3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-ylidene]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 121390570 |
| Molecular Formula | C17H14F5N5O3S2 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 5-(1-cyanocyclopropyl)-3-ethylsulfonyl-N-[3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-ylidene]pyridine-2-carboxamide |
| SMILES | CCS(=O)(=O)c1cc(C2(C#N)CC2)cnc1C(=O)/N=c1\sc(C(F)(F)C(F)(F)F)nn1C |
| InChI | InChI=1S/C17H14F5N5O3S2/c1-3-32(29,30)10-6-9(15(8-23)4-5-15)7-24-11(10)12(28)25-14-27(2)26-13(31-14)16(18,19)17(20,21)22/h6-7H,3-5H2,1-2H3/b25-14- |
| InChIKey | CLTXELUYXZBPRB-QFEZKATASA-N |
| XLogP | 2.62 |
| TPSA | 118.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|