C31H38O9 — CID 121390724
bis[[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl] carbonate (PubChem CID 121390724) has the molecular formula C31H38O9 and a molecular weight of 554.64 g/mol. Its IUPAC name is bis[[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl] carbonate.
| Compound Name | bis[[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl] carbonate |
|---|---|
| PubChem CID | 121390724 |
| Molecular Formula | C31H38O9 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | bis[[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl] carbonate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)OC/C1=C/CC[C@@]3(C)O[C@H]3[C@H]3OC(=O)C(=C)[C@@H]3CC1)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C31H38O9/c1-17-21-11-9-19(7-5-13-30(3)25(39-30)23(21)37-27(17)32)15-35-29(34)36-16-20-8-6-14-31(4)26(40-31)24-22(12-10-20)18(2)28(33)38-24/h7-8,21-26H,1-2,5-6,9-16H2,3-4H3/b19-7+,20-8+/t21-,22-,23-,24-,25-,26-,30+,31+/m0/s1 |
| InChIKey | GZHMIWVGBOYMHP-HLKHRQEYSA-N |
| XLogP | 4.65 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|