C20H25FO2 — CID 121391146
(8R,9S,13S,14S)-3-(1-fluoroethoxy)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 121391146) has the molecular formula C20H25FO2 and a molecular weight of 316.42 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-(1-fluoroethoxy)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-(1-fluoroethoxy)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 121391146 |
| Molecular Formula | C20H25FO2 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (8R,9S,13S,14S)-3-(1-fluoroethoxy)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC(F)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H25FO2/c1-12(21)23-14-4-6-15-13(11-14)3-5-17-16(15)9-10-20(2)18(17)7-8-19(20)22/h4,6,11-12,16-18H,3,5,7-10H2,1-2H3/t12?,16-,17-,18+,20+/m1/s1 |
| InChIKey | GRGDXDYFTYCRAU-WJQMJBKZSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |