C20H26N8O5 — CID 121391934
N-(2-aminoethyl)-2-[9-[2-(diaminomethylideneamino)ethoxy]-2-oxo-10H-pyrimido[5,4-b][1,4]benzoxazin-3-yl]-N-(2-oxopropyl)acetamide (PubChem CID 121391934) has the molecular formula C20H26N8O5 and a molecular weight of 458.48 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[9-[2-(diaminomethylideneamino)ethoxy]-2-oxo-10H-pyrimido[5,4-b][1,4]benzoxazin-3-yl]-N-(2-oxopropyl)acetamide.
| Compound Name | N-(2-aminoethyl)-2-[9-[2-(diaminomethylideneamino)ethoxy]-2-oxo-10H-pyrimido[5,4-b][1,4]benzoxazin-3-yl]-N-(2-oxopropyl)acetamide |
|---|---|
| PubChem CID | 121391934 |
| Molecular Formula | C20H26N8O5 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-(2-aminoethyl)-2-[9-[2-(diaminomethylideneamino)ethoxy]-2-oxo-10H-pyrimido[5,4-b][1,4]benzoxazin-3-yl]-N-(2-oxopropyl)acetamide |
| SMILES | CC(=O)CN(CCN)C(=O)Cn1cc2c(nc1=O)Nc1c(OCCN=C(N)N)cccc1O2 |
| InChI | InChI=1S/C20H26N8O5/c1-12(29)9-27(7-5-21)16(30)11-28-10-15-18(26-20(28)31)25-17-13(3-2-4-14(17)33-15)32-8-6-24-19(22)23/h2-4,10H,5-9,11,21H2,1H3,(H4,22,23,24)(H,25,26,31) |
| InChIKey | GHJBOHMIGZMPTB-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 193.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|