C16H28N2O2 — CID 121391951
(2E)-N-[(2S,3R)-1-amino-3-methoxypent-4-en-2-yl]-3,7-dimethylocta-2,6-dienamide (PubChem CID 121391951) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is (2E)-N-[(2S,3R)-1-amino-3-methoxypent-4-en-2-yl]-3,7-dimethylocta-2,6-dienamide.
| Compound Name | (2E)-N-[(2S,3R)-1-amino-3-methoxypent-4-en-2-yl]-3,7-dimethylocta-2,6-dienamide |
|---|---|
| PubChem CID | 121391951 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (2E)-N-[(2S,3R)-1-amino-3-methoxypent-4-en-2-yl]-3,7-dimethylocta-2,6-dienamide |
| SMILES | C=C[C@@H](OC)[C@H](CN)NC(=O)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H28N2O2/c1-6-15(20-5)14(11-17)18-16(19)10-13(4)9-7-8-12(2)3/h6,8,10,14-15H,1,7,9,11,17H2,2-5H3,(H,18,19)/b13-10+/t14-,15+/m0/s1 |
| InChIKey | LJTGWGPBWNIXAV-XEZFYOOLSA-N |
| XLogP | 2.32 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|