About N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide
N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide (PubChem CID 121391957) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide |
| PubChem CID | 121391957 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide |
| SMILES | C=C[C@@H](OC)[C@H](CN(C)C)NC(C)=O |
| InChI | InChI=1S/C10H20N2O2/c1-6-10(14-5)9(7-12(3)4)11-8(2)13/h6,9-10H,1,7H2,2-5H3,(H,11,13)/t9-,10+/m0/s1 |
| InChIKey | WSQSCYNAMGDQLL-VHSXEESVSA-N |
| XLogP | 0.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide?
The IUPAC name of N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide (CID 121391957) is N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide.
What is the SMILES notation for N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide?
The canonical SMILES for N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide is C=C[C@@H](OC)[C@H](CN(C)C)NC(C)=O.
What is the InChIKey of N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide?
The InChIKey is WSQSCYNAMGDQLL-VHSXEESVSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-6-10(14-5)9(7-12(3)4)11-8(2)13/h6,9-10H,1,7H2,2-5H3,(H,11,13)/t9-,10+/m0/s1.
What are the key properties of N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide?
N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide has a molecular weight of 200.28 g/mol, XLogP of 0.25, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,3R)-1-(dimethylamino)-3-methoxypent-4-en-2-yl]acetamide is sourced from PubChem (CID 121391957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).