C20H40OS — CID 121392157
trans-(1S,2S)-2-tetradecylsulfanylcyclohexan-1-ol (PubChem CID 121392157) has the molecular formula C20H40OS and a molecular weight of 328.61 g/mol. Its IUPAC name is trans-(1S,2S)-2-tetradecylsulfanylcyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-tetradecylsulfanylcyclohexan-1-ol |
|---|---|
| PubChem CID | 121392157 |
| Molecular Formula | C20H40OS |
| Molecular Weight | 328.61 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | trans-(1S,2S)-2-tetradecylsulfanylcyclohexan-1-ol |
| SMILES | CCCCCCCCCCCCCCS[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C20H40OS/c1-2-3-4-5-6-7-8-9-10-11-12-15-18-22-20-17-14-13-16-19(20)21/h19-21H,2-18H2,1H3/t19-,20-/m0/s1 |
| InChIKey | YCNKLHFJRVMSSY-PMACEKPBSA-N |
| XLogP | 6.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.61 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|