C30H26N4O3 — CID 121392249
5-N,6-N-dibenzyl-7-(4-methoxyphenyl)imidazo[1,2-a]pyridine-5,6-dicarboxamide (PubChem CID 121392249) has the molecular formula C30H26N4O3 and a molecular weight of 490.56 g/mol. Its IUPAC name is 5-N,6-N-dibenzyl-7-(4-methoxyphenyl)imidazo[1,2-a]pyridine-5,6-dicarboxamide.
| Compound Name | 5-N,6-N-dibenzyl-7-(4-methoxyphenyl)imidazo[1,2-a]pyridine-5,6-dicarboxamide |
|---|---|
| PubChem CID | 121392249 |
| Molecular Formula | C30H26N4O3 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 5-N,6-N-dibenzyl-7-(4-methoxyphenyl)imidazo[1,2-a]pyridine-5,6-dicarboxamide |
| SMILES | COc1ccc(-c2cc3nccn3c(C(=O)NCc3ccccc3)c2C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H26N4O3/c1-37-24-14-12-23(13-15-24)25-18-26-31-16-17-34(26)28(30(36)33-20-22-10-6-3-7-11-22)27(25)29(35)32-19-21-8-4-2-5-9-21/h2-18H,19-20H2,1H3,(H,32,35)(H,33,36) |
| InChIKey | UBYSPIGZMUUQKG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |