C11H17N7 — CID 121392562
2,3-bis(aminomethyl)-6-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 121392562) has the molecular formula C11H17N7 and a molecular weight of 247.31 g/mol. Its IUPAC name is 2,3-bis(aminomethyl)-6-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2,3-bis(aminomethyl)-6-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 121392562 |
| Molecular Formula | C11H17N7 |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 2,3-bis(aminomethyl)-6-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | NCN1C(N)=NC(c2ccccc2)=NC1(N)CN |
| InChI | InChI=1S/C11H17N7/c12-6-11(15)17-9(8-4-2-1-3-5-8)16-10(14)18(11)7-13/h1-5H,6-7,12-13,15H2,(H2,14,16,17) |
| InChIKey | SIIRKVOCTLUFBO-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |