About 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde
1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde (PubChem CID 121392596) has the molecular formula C19H23NO
and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde |
| PubChem CID | 121392596 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde |
| SMILES | O=CN1Cc2ccccc2C1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H23NO/c21-12-20-11-16-3-1-2-4-17(16)18(20)19-8-13-5-14(9-19)7-15(6-13)10-19/h1-4,12-15,18H,5-11H2 |
| InChIKey | DTCSNIDEYPRZLF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde?
The IUPAC name of 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde (CID 121392596) is 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde.
What is the SMILES notation for 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde?
The canonical SMILES for 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde is O=CN1Cc2ccccc2C1C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde?
The InChIKey is DTCSNIDEYPRZLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO/c21-12-20-11-16-3-1-2-4-17(16)18(20)19-8-13-5-14(9-19)7-15(6-13)10-19/h1-4,12-15,18H,5-11H2.
What are the key properties of 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde?
1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde has a molecular weight of 281.40 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-1,3-dihydroisoindole-2-carbaldehyde is sourced from PubChem (CID 121392596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).