About 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide
4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide (PubChem CID 121393407) has the molecular formula C22H28ClF2N3O
and a molecular weight of 423.94 g/mol. Its IUPAC name is 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide |
| PubChem CID | 121393407 |
| Molecular Formula | C22H28ClF2N3O |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide |
| SMILES | O=C(NCC1CCC(F)(F)CC1)c1cn(CC2CCNCC2)c2cccc(Cl)c12 |
| InChI | InChI=1S/C22H28ClF2N3O/c23-18-2-1-3-19-20(18)17(14-28(19)13-16-6-10-26-11-7-16)21(29)27-12-15-4-8-22(24,25)9-5-15/h1-3,14-16,26H,4-13H2,(H,27,29) |
| InChIKey | HGEBTOZUHJCFPT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide?
The IUPAC name of 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide (CID 121393407) is 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide.
What is the SMILES notation for 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide?
The canonical SMILES for 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide is O=C(NCC1CCC(F)(F)CC1)c1cn(CC2CCNCC2)c2cccc(Cl)c12.
What is the InChIKey of 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide?
The InChIKey is HGEBTOZUHJCFPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28ClF2N3O/c23-18-2-1-3-19-20(18)17(14-28(19)13-16-6-10-26-11-7-16)21(29)27-12-15-4-8-22(24,25)9-5-15/h1-3,14-16,26H,4-13H2,(H,27,29).
What are the key properties of 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide?
4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide has a molecular weight of 423.94 g/mol, XLogP of 4.85, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(4,4-difluorocyclohexyl)methyl]-1-(piperidin-4-ylmethyl)indole-3-carboxamide is sourced from PubChem (CID 121393407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).