C20H25ClN2O3 — CID 121393489
4-chloro-N-[(1-hydroxy-3-methylcyclohexyl)methyl]-1-(oxetan-3-yl)indole-3-carboxamide (PubChem CID 121393489) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is 4-chloro-N-[(1-hydroxy-3-methylcyclohexyl)methyl]-1-(oxetan-3-yl)indole-3-carboxamide.
| Compound Name | 4-chloro-N-[(1-hydroxy-3-methylcyclohexyl)methyl]-1-(oxetan-3-yl)indole-3-carboxamide |
|---|---|
| PubChem CID | 121393489 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-chloro-N-[(1-hydroxy-3-methylcyclohexyl)methyl]-1-(oxetan-3-yl)indole-3-carboxamide |
| SMILES | CC1CCCC(O)(CNC(=O)c2cn(C3COC3)c3cccc(Cl)c23)C1 |
| InChI | InChI=1S/C20H25ClN2O3/c1-13-4-3-7-20(25,8-13)12-22-19(24)15-9-23(14-10-26-11-14)17-6-2-5-16(21)18(15)17/h2,5-6,9,13-14,25H,3-4,7-8,10-12H2,1H3,(H,22,24) |
| InChIKey | XEPOYNHLFNATQO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |