C13H11ClFN3O2 — CID 121393627
(5R)-5-[(7-chloro-6-fluoro-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione (PubChem CID 121393627) has the molecular formula C13H11ClFN3O2 and a molecular weight of 295.70 g/mol. Its IUPAC name is (5R)-5-[(7-chloro-6-fluoro-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(7-chloro-6-fluoro-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121393627 |
| Molecular Formula | C13H11ClFN3O2 |
| Molecular Weight | 295.70 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (5R)-5-[(7-chloro-6-fluoro-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N[C@H](Cc2c[nH]c3c(Cl)c(F)ccc23)C1=O |
| InChI | InChI=1S/C13H11ClFN3O2/c1-18-12(19)9(17-13(18)20)4-6-5-16-11-7(6)2-3-8(15)10(11)14/h2-3,5,9,16H,4H2,1H3,(H,17,20)/t9-/m1/s1 |
| InChIKey | BCTSGIVMFVGZSI-SECBINFHSA-N |
| XLogP | 2.05 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.70 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|